C19H19N3OS — CID 1430254
4-(1,3-benzoxazol-2-yl)-N-phenylpiperidine-1-carbothioamide (PubChem CID 1430254) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-yl)-N-phenylpiperidine-1-carbothioamide.
| Compound Name | 4-(1,3-benzoxazol-2-yl)-N-phenylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 1430254 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-(1,3-benzoxazol-2-yl)-N-phenylpiperidine-1-carbothioamide |
| SMILES | S=C(Nc1ccccc1)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C19H19N3OS/c24-19(20-15-6-2-1-3-7-15)22-12-10-14(11-13-22)18-21-16-8-4-5-9-17(16)23-18/h1-9,14H,10-13H2,(H,20,24) |
| InChIKey | JSGXQVMOKPANIU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|