C26H24N4O3 — CID 39952257
1-[4-[4-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-3-phenylurea (PubChem CID 39952257) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is 1-[4-[4-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[4-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 39952257 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[4-[4-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)N2CCC(c3nc4ccccc4o3)CC2)cc1 |
| InChI | InChI=1S/C26H24N4O3/c31-25(19-10-12-21(13-11-19)28-26(32)27-20-6-2-1-3-7-20)30-16-14-18(15-17-30)24-29-22-8-4-5-9-23(22)33-24/h1-13,18H,14-17H2,(H2,27,28,32) |
| InChIKey | APYSMRHNOISCIV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |