C19H17ClFN3OS — CID 21008648
3-(1,3-benzoxazol-2-yl)-N-(3-chloro-4-fluorophenyl)piperidine-1-carbothioamide (PubChem CID 21008648) has the molecular formula C19H17ClFN3OS and a molecular weight of 389.88 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-N-(3-chloro-4-fluorophenyl)piperidine-1-carbothioamide.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-N-(3-chloro-4-fluorophenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 21008648 |
| Molecular Formula | C19H17ClFN3OS |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-N-(3-chloro-4-fluorophenyl)piperidine-1-carbothioamide |
| SMILES | Fc1ccc(NC(=S)N2CCCC(c3nc4ccccc4o3)C2)cc1Cl |
| InChI | InChI=1S/C19H17ClFN3OS/c20-14-10-13(7-8-15(14)21)22-19(26)24-9-3-4-12(11-24)18-23-16-5-1-2-6-17(16)25-18/h1-2,5-8,10,12H,3-4,9,11H2,(H,22,26) |
| InChIKey | JSGNTJOEDAJLDV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|