C20H20N4O3S — CID 112839749
4-(1,3-benzothiazol-2-yl)-N-(3-methyl-4-nitrophenyl)piperidine-1-carboxamide (PubChem CID 112839749) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-(3-methyl-4-nitrophenyl)piperidine-1-carboxamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-(3-methyl-4-nitrophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 112839749 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-(3-methyl-4-nitrophenyl)piperidine-1-carboxamide |
| SMILES | Cc1cc(NC(=O)N2CCC(c3nc4ccccc4s3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N4O3S/c1-13-12-15(6-7-17(13)24(26)27)21-20(25)23-10-8-14(9-11-23)19-22-16-4-2-3-5-18(16)28-19/h2-7,12,14H,8-11H2,1H3,(H,21,25) |
| InChIKey | GLGUGJKERJGKFY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|