C23H20N4O3S3 — CID 27782438
[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone (PubChem CID 27782438) has the molecular formula C23H20N4O3S3 and a molecular weight of 496.64 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone.
| Compound Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 27782438 |
| Molecular Formula | C23H20N4O3S3 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [4-(1,3-benzothiazol-2-yl)piperidin-1-yl]-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone |
| SMILES | Cc1csc(Sc2ccc(C(=O)N3CCC(c4nc5ccccc5s4)CC3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C23H20N4O3S3/c1-14-13-31-23(24-14)33-20-7-6-16(12-18(20)27(29)30)22(28)26-10-8-15(9-11-26)21-25-17-4-2-3-5-19(17)32-21/h2-7,12-13,15H,8-11H2,1H3 |
| InChIKey | NDRSWWVOMREXGR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|