C16H19ClN4O3S2 — CID 119374540
(4-aminopiperidin-1-yl)-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride (PubChem CID 119374540) has the molecular formula C16H19ClN4O3S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride.
| Compound Name | (4-aminopiperidin-1-yl)-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119374540 |
| Molecular Formula | C16H19ClN4O3S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-3-nitrophenyl]methanone;hydrochloride |
| SMILES | Cc1csc(Sc2ccc(C(=O)N3CCC(N)CC3)cc2[N+](=O)[O-])n1.Cl |
| InChI | InChI=1S/C16H18N4O3S2.ClH/c1-10-9-24-16(18-10)25-14-3-2-11(8-13(14)20(22)23)15(21)19-6-4-12(17)5-7-19;/h2-3,8-9,12H,4-7,17H2,1H3;1H |
| InChIKey | LZRWNQGJQUMUQM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|