C20H19N3O3S2 — CID 9233562
1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(2-nitrophenyl)sulfanylethanone (PubChem CID 9233562) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(2-nitrophenyl)sulfanylethanone.
| Compound Name | 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(2-nitrophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 9233562 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 1-[(3R)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-(2-nitrophenyl)sulfanylethanone |
| SMILES | O=C(CSc1ccccc1[N+](=O)[O-])N1CCC[C@@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C20H19N3O3S2/c24-19(13-27-18-10-4-2-8-16(18)23(25)26)22-11-5-6-14(12-22)20-21-15-7-1-3-9-17(15)28-20/h1-4,7-10,14H,5-6,11-13H2/t14-/m1/s1 |
| InChIKey | RIFSMGBDAOJGEL-CQSZACIVSA-N |
| XLogP | 4.70 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|