C20H16F3N3O3S2 — CID 55329164
1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone (PubChem CID 55329164) has the molecular formula C20H16F3N3O3S2 and a molecular weight of 467.49 g/mol. Its IUPAC name is 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone.
| Compound Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
|---|---|
| PubChem CID | 55329164 |
| Molecular Formula | C20H16F3N3O3S2 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | 1-[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-])N1CCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H16F3N3O3S2/c21-20(22,23)12-7-8-17(15(10-12)26(28)29)30-11-18(27)25-9-3-5-14(25)19-24-13-4-1-2-6-16(13)31-19/h1-2,4,6-8,10,14H,3,5,9,11H2 |
| InChIKey | GIOIKYQOBZDKFF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|