C17H16N4O3S — CID 9489127
[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-nitro-1H-pyrrol-2-yl)methanone (PubChem CID 9489127) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-nitro-1H-pyrrol-2-yl)methanone.
| Compound Name | [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-nitro-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 9489127 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-(4-nitro-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])c[nH]1)N1CCC[C@H](c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C17H16N4O3S/c22-17(14-8-12(9-18-14)21(23)24)20-7-3-4-11(10-20)16-19-13-5-1-2-6-15(13)25-16/h1-2,5-6,8-9,11,18H,3-4,7,10H2/t11-/m0/s1 |
| InChIKey | SGALANOSNUOZNH-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|