C20H20N4O2S — CID 9223949
[3-[(3R)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]urea (PubChem CID 9223949) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is [3-[(3R)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]urea.
| Compound Name | [3-[(3R)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 9223949 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [3-[(3R)-3-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]phenyl]urea |
| SMILES | NC(=O)Nc1cccc(C(=O)N2CCC[C@@H](c3nc4ccccc4s3)C2)c1 |
| InChI | InChI=1S/C20H20N4O2S/c21-20(26)22-15-7-3-5-13(11-15)19(25)24-10-4-6-14(12-24)18-23-16-8-1-2-9-17(16)27-18/h1-3,5,7-9,11,14H,4,6,10,12H2,(H3,21,22,26)/t14-/m1/s1 |
| InChIKey | ZMGCYHVMEBPRTM-CQSZACIVSA-N |
| XLogP | 3.81 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |