C23H27N5O2 — CID 99808037
[3-[(3R)-3-(1-propan-2-ylbenzimidazol-2-yl)piperidine-1-carbonyl]phenyl]urea (PubChem CID 99808037) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is [3-[(3R)-3-(1-propan-2-ylbenzimidazol-2-yl)piperidine-1-carbonyl]phenyl]urea.
| Compound Name | [3-[(3R)-3-(1-propan-2-ylbenzimidazol-2-yl)piperidine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 99808037 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [3-[(3R)-3-(1-propan-2-ylbenzimidazol-2-yl)piperidine-1-carbonyl]phenyl]urea |
| SMILES | CC(C)n1c([C@@H]2CCCN(C(=O)c3cccc(NC(N)=O)c3)C2)nc2ccccc21 |
| InChI | InChI=1S/C23H27N5O2/c1-15(2)28-20-11-4-3-10-19(20)26-21(28)17-8-6-12-27(14-17)22(29)16-7-5-9-18(13-16)25-23(24)30/h3-5,7,9-11,13,15,17H,6,8,12,14H2,1-2H3,(H3,24,25,30)/t17-/m1/s1 |
| InChIKey | RJRNPISORYZQIG-QGZVFWFLSA-N |
| XLogP | 4.13 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |