C26H25N3O3 — CID 24513270
3-[3-[(E)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile (PubChem CID 24513270) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-[3-[(E)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(E)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 24513270 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[3-[(E)-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(/C=C/C(=O)N2CCCC2c2ccc3c(c2)OCCO3)c2ccccc21 |
| InChI | InChI=1S/C26H25N3O3/c27-12-4-13-28-18-20(21-5-1-2-6-23(21)28)9-11-26(30)29-14-3-7-22(29)19-8-10-24-25(17-19)32-16-15-31-24/h1-2,5-6,8-11,17-18,22H,3-4,7,13-16H2/b11-9+ |
| InChIKey | KMUAPOOUEHBBEG-PKNBQFBNSA-N |
| XLogP | 4.70 |
| TPSA | 67.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|