C25H26N4O — CID 9338428
3-[3-[(E)-3-(4-benzylpiperazin-1-yl)-3-oxoprop-1-enyl]indol-1-yl]propanenitrile (PubChem CID 9338428) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[3-[(E)-3-(4-benzylpiperazin-1-yl)-3-oxoprop-1-enyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(E)-3-(4-benzylpiperazin-1-yl)-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 9338428 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[3-[(E)-3-(4-benzylpiperazin-1-yl)-3-oxoprop-1-enyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(/C=C/C(=O)N2CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H26N4O/c26-13-6-14-29-20-22(23-9-4-5-10-24(23)29)11-12-25(30)28-17-15-27(16-18-28)19-21-7-2-1-3-8-21/h1-5,7-12,20H,6,14-19H2/b12-11+ |
| InChIKey | AUZVPEYAQLEGQM-VAWYXSNFSA-N |
| XLogP | 3.91 |
| TPSA | 52.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|