C28H27N5O — CID 55622345
(E)-N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide (PubChem CID 55622345) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is (E)-N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55622345 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (E)-N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)NC2CCCc3c2cnn3Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C28H27N5O/c29-16-7-17-32-20-22(23-10-4-5-12-26(23)32)14-15-28(34)31-25-11-6-13-27-24(25)18-30-33(27)19-21-8-2-1-3-9-21/h1-5,8-10,12,14-15,18,20,25H,6-7,11,13,17,19H2,(H,31,34)/b15-14+ |
| InChIKey | IQLKGVWMUVFKCJ-CCEZHUSRSA-N |
| XLogP | 5.01 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|