C22H28N4O — CID 94187302
1-[(4R)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(dicyclopropylmethyl)urea (PubChem CID 94187302) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[(4R)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(dicyclopropylmethyl)urea.
| Compound Name | 1-[(4R)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(dicyclopropylmethyl)urea |
|---|---|
| PubChem CID | 94187302 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1-[(4R)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(dicyclopropylmethyl)urea |
| SMILES | O=C(NC(C1CC1)C1CC1)N[C@@H]1CCCc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C22H28N4O/c27-22(25-21(16-9-10-16)17-11-12-17)24-19-7-4-8-20-18(19)13-23-26(20)14-15-5-2-1-3-6-15/h1-3,5-6,13,16-17,19,21H,4,7-12,14H2,(H2,24,25,27)/t19-/m1/s1 |
| InChIKey | UZEXGWSLHYBDEW-LJQANCHMSA-N |
| XLogP | 3.80 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |