C24H25N5O — CID 55751536
1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(4-cyanophenyl)ethyl]urea (PubChem CID 55751536) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(4-cyanophenyl)ethyl]urea.
| Compound Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(4-cyanophenyl)ethyl]urea |
|---|---|
| PubChem CID | 55751536 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-[1-(4-cyanophenyl)ethyl]urea |
| SMILES | CC(NC(=O)NC1CCCc2c1cnn2Cc1ccccc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H25N5O/c1-17(20-12-10-18(14-25)11-13-20)27-24(30)28-22-8-5-9-23-21(22)15-26-29(23)16-19-6-3-2-4-7-19/h2-4,6-7,10-13,15,17,22H,5,8-9,16H2,1H3,(H2,27,28,30) |
| InChIKey | JRVSAEQBCJDKFU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |