C19H26N4O2 — CID 110892499
1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-hydroxybutan-2-yl)urea (PubChem CID 110892499) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 110892499 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)NC1CCCc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C19H26N4O2/c1-2-15(13-24)21-19(25)22-17-9-6-10-18-16(17)11-20-23(18)12-14-7-4-3-5-8-14/h3-5,7-8,11,15,17,24H,2,6,9-10,12-13H2,1H3,(H2,21,22,25) |
| InChIKey | ZYWYRFPONXBYBO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |