C22H24N4O — CID 51939747
1-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(4-methylphenyl)urea (PubChem CID 51939747) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 51939747 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N[C@H]2CCCc3c2cnn3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-16-10-12-18(13-11-16)24-22(27)25-20-8-5-9-21-19(20)14-23-26(21)15-17-6-3-2-4-7-17/h2-4,6-7,10-14,20H,5,8-9,15H2,1H3,(H2,24,25,27)/t20-/m0/s1 |
| InChIKey | RDTUAVRSJFZTEP-FQEVSTJZSA-N |
| XLogP | 4.44 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |