C19H23N7O — CID 167955144
1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-ethyltriazol-4-yl)urea (PubChem CID 167955144) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-ethyltriazol-4-yl)urea.
| Compound Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-ethyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 167955144 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-3-(1-ethyltriazol-4-yl)urea |
| SMILES | CCn1cc(NC(=O)NC2CCCc3c2cnn3Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H23N7O/c1-2-25-13-18(23-24-25)22-19(27)21-16-9-6-10-17-15(16)11-20-26(17)12-14-7-4-3-5-8-14/h3-5,7-8,11,13,16H,2,6,9-10,12H2,1H3,(H2,21,22,27) |
| InChIKey | LKMILCDRDNULKV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |