C22H21N7O — CID 167989084
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-phenyltetrazole-5-carboxamide (PubChem CID 167989084) has the molecular formula C22H21N7O and a molecular weight of 399.46 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-phenyltetrazole-5-carboxamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-phenyltetrazole-5-carboxamide |
|---|---|
| PubChem CID | 167989084 |
| Molecular Formula | C22H21N7O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-2-phenyltetrazole-5-carboxamide |
| SMILES | O=C(NC1CCCc2c1cnn2Cc1ccccc1)c1nnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H21N7O/c30-22(21-25-27-29(26-21)17-10-5-2-6-11-17)24-19-12-7-13-20-18(19)14-23-28(20)15-16-8-3-1-4-9-16/h1-6,8-11,14,19H,7,12-13,15H2,(H,24,30) |
| InChIKey | DPTYVSDZQKDQPR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |