C21H19F2N3O — CID 31899002
N-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-2,5-difluorobenzamide (PubChem CID 31899002) has the molecular formula C21H19F2N3O and a molecular weight of 367.40 g/mol. Its IUPAC name is N-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-2,5-difluorobenzamide.
| Compound Name | N-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 31899002 |
| Molecular Formula | C21H19F2N3O |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]-2,5-difluorobenzamide |
| SMILES | O=C(N[C@H]1CCCc2c1cnn2Cc1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C21H19F2N3O/c22-15-9-10-18(23)16(11-15)21(27)25-19-7-4-8-20-17(19)12-24-26(20)13-14-5-2-1-3-6-14/h1-3,5-6,9-12,19H,4,7-8,13H2,(H,25,27)/t19-/m0/s1 |
| InChIKey | HFXGNQHDGYGKHY-IBGZPJMESA-N |
| XLogP | 4.02 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |