C22H20FN5OS — CID 78903546
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78903546) has the molecular formula C22H20FN5OS and a molecular weight of 421.50 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78903546 |
| Molecular Formula | C22H20FN5OS |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(NC1CCCc2c1cnn2Cc1ccccc1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C22H20FN5OS/c23-14-9-15(20-18(10-14)26-22(30)27-20)21(29)25-17-7-4-8-19-16(17)11-24-28(19)12-13-5-2-1-3-6-13/h1-3,5-6,9-11,17H,4,7-8,12H2,(H,25,29)(H2,26,27,30) |
| InChIKey | IQMWZRUITGWDGV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|