C25H29FN4O3S — CID 55622374
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide (PubChem CID 55622374) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 55622374 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-5-(diethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)NC2CCCc3c2cnn3Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-3-29(4-2)34(32,33)19-13-14-22(26)20(15-19)25(31)28-23-11-8-12-24-21(23)16-27-30(24)17-18-9-6-5-7-10-18/h5-7,9-10,13-16,23H,3-4,8,11-12,17H2,1-2H3,(H,28,31) |
| InChIKey | IYOYSCHLPGVUIV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |