C26H29FN4O3S — CID 46424971
N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 46424971) has the molecular formula C26H29FN4O3S and a molecular weight of 496.61 g/mol. Its IUPAC name is N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 46424971 |
| Molecular Formula | C26H29FN4O3S |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-(1-benzyl-4,5,6,7-tetrahydroindazol-4-yl)-4-fluoro-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(NC1CCCc2c1cnn2Cc1ccccc1)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C26H29FN4O3S/c27-22-13-12-20(16-25(22)35(33,34)30-14-5-2-6-15-30)26(32)29-23-10-7-11-24-21(23)17-28-31(24)18-19-8-3-1-4-9-19/h1,3-4,8-9,12-13,16-17,23H,2,5-7,10-11,14-15,18H2,(H,29,32) |
| InChIKey | WRMBBHIQOLHKTA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |