C18H17N5 — CID 39323178
2-[[[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methylidene]propanedinitrile (PubChem CID 39323178) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-[[[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methylidene]propanedinitrile.
| Compound Name | 2-[[[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 39323178 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[[[(4S)-1-benzyl-4,5,6,7-tetrahydroindazol-4-yl]amino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CN[C@H]1CCCc2c1cnn2Cc1ccccc1 |
| InChI | InChI=1S/C18H17N5/c19-9-15(10-20)11-21-17-7-4-8-18-16(17)12-22-23(18)13-14-5-2-1-3-6-14/h1-3,5-6,11-12,17,21H,4,7-8,13H2/t17-/m0/s1 |
| InChIKey | MDULICWZGAHXKT-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|