C22H18N4OS — CID 8780624
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide (PubChem CID 8780624) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8780624 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-(2-methyl-1,3-benzothiazol-6-yl)prop-2-enamide |
| SMILES | Cc1nc2ccc(NC(=O)/C=C/c3cn(CCC#N)c4ccccc34)cc2s1 |
| InChI | InChI=1S/C22H18N4OS/c1-15-24-19-9-8-17(13-21(19)28-15)25-22(27)10-7-16-14-26(12-4-11-23)20-6-3-2-5-18(16)20/h2-3,5-10,13-14H,4,12H2,1H3,(H,25,27)/b10-7+ |
| InChIKey | MAVNZQSIWFWTFR-JXMROGBWSA-N |
| XLogP | 5.12 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|