C26H21ClN4O2 — CID 55804363
(E)-N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide (PubChem CID 55804363) has the molecular formula C26H21ClN4O2 and a molecular weight of 456.93 g/mol. Its IUPAC name is (E)-N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide.
| Compound Name | (E)-N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55804363 |
| Molecular Formula | C26H21ClN4O2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (E)-N-[1-[(2-chlorophenyl)methyl]-6-oxo-3-pyridinyl]-3-[1-(2-cyanoethyl)indol-3-yl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)Nc2ccc(=O)n(Cc3ccccc3Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C26H21ClN4O2/c27-23-8-3-1-6-20(23)17-31-18-21(11-13-26(31)33)29-25(32)12-10-19-16-30(15-5-14-28)24-9-4-2-7-22(19)24/h1-4,6-13,16,18H,5,15,17H2,(H,29,32)/b12-10+ |
| InChIKey | DXUJGWLFIVHWPU-ZRDIBKRKSA-N |
| XLogP | 5.07 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|