C26H24N6O2 — CID 55979622
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide (PubChem CID 55979622) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55979622 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[[3-[(2-pyrazol-1-ylacetyl)amino]phenyl]methyl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)NCc2cccc(NC(=O)Cn3cccn3)c2)c2ccccc21 |
| InChI | InChI=1S/C26H24N6O2/c27-12-4-14-31-18-21(23-8-1-2-9-24(23)31)10-11-25(33)28-17-20-6-3-7-22(16-20)30-26(34)19-32-15-5-13-29-32/h1-3,5-11,13,15-16,18H,4,14,17,19H2,(H,28,33)(H,30,34)/b11-10+ |
| InChIKey | XISDKKUINGCBMN-ZHACJKMWSA-N |
| XLogP | 3.72 |
| TPSA | 104.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|