C25H26N4O2 — CID 55677403
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]prop-2-enamide (PubChem CID 55677403) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55677403 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)NCc2cccnc2OC2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C25H26N4O2/c26-14-6-16-29-18-20(22-10-3-4-11-23(22)29)12-13-24(30)28-17-19-7-5-15-27-25(19)31-21-8-1-2-9-21/h3-5,7,10-13,15,18,21H,1-2,6,8-9,16-17H2,(H,28,30)/b13-12+ |
| InChIKey | YBERINYEMFEDPN-OUKQBFOZSA-N |
| XLogP | 4.60 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|