C24H27N3O3 — CID 55677552
(E)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 55677552) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (E)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55677552 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (E)-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)NCc1cccnc1OC1CCCC1 |
| InChI | InChI=1S/C24H27N3O3/c28-22(14-11-18-9-12-20(13-10-18)27-16-4-8-23(27)29)26-17-19-5-3-15-25-24(19)30-21-6-1-2-7-21/h3,5,9-15,21H,1-2,4,6-8,16-17H2,(H,26,28)/b14-11+ |
| InChIKey | FGJBWRRIJNGPAZ-SDNWHVSQSA-N |
| XLogP | 3.86 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|