C18H20N4O3 — CID 86987743
1-[(2-methoxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea (PubChem CID 86987743) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[(2-methoxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-[(2-methoxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 86987743 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-[(2-methoxy-3-pyridinyl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea |
| SMILES | COc1ncccc1CNC(=O)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H20N4O3/c1-25-17-13(4-2-10-19-17)12-20-18(24)21-14-6-8-15(9-7-14)22-11-3-5-16(22)23/h2,4,6-10H,3,5,11-12H2,1H3,(H2,20,21,24) |
| InChIKey | VLBVRTPEQMNDQG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |