C22H25N5O4 — CID 47041898
1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea (PubChem CID 47041898) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 47041898 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[4-(2,6-dioxopiperidin-1-yl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1cccnc1N1CCOCC1)Nc1ccc(N2C(=O)CCCC2=O)cc1 |
| InChI | InChI=1S/C22H25N5O4/c28-19-4-1-5-20(29)27(19)18-8-6-17(7-9-18)25-22(30)24-15-16-3-2-10-23-21(16)26-11-13-31-14-12-26/h2-3,6-10H,1,4-5,11-15H2,(H2,24,25,30) |
| InChIKey | KSRJRWRFRDIVTO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|