C23H26N4O4 — CID 47050133
1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea (PubChem CID 47050133) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea.
| Compound Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 47050133 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[(2-morpholin-4-yl-3-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1cccnc1N1CCOCC1)Nc1cccc(COCc2ccco2)c1 |
| InChI | InChI=1S/C23H26N4O4/c28-23(25-15-19-5-2-8-24-22(19)27-9-12-29-13-10-27)26-20-6-1-4-18(14-20)16-30-17-21-7-3-11-31-21/h1-8,11,14H,9-10,12-13,15-17H2,(H2,25,26,28) |
| InChIKey | CCNSAWHTWOLFRH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |