C16H20N2O4S — CID 95630481
1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[2-[(S)-methylsulfinyl]ethyl]urea (PubChem CID 95630481) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[2-[(S)-methylsulfinyl]ethyl]urea.
| Compound Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[2-[(S)-methylsulfinyl]ethyl]urea |
|---|---|
| PubChem CID | 95630481 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxymethyl)phenyl]-3-[2-[(S)-methylsulfinyl]ethyl]urea |
| SMILES | C[S@](=O)CCNC(=O)Nc1cccc(COCc2ccco2)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-23(20)9-7-17-16(19)18-14-5-2-4-13(10-14)11-21-12-15-6-3-8-22-15/h2-6,8,10H,7,9,11-12H2,1H3,(H2,17,18,19)/t23-/m0/s1 |
| InChIKey | RCYXJKWPELXIRE-QHCPKHFHSA-N |
| XLogP | 2.50 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |