C22H23N5O2 — CID 55695718
1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea (PubChem CID 55695718) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55695718 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[4-(2-oxopyrrolidin-1-yl)phenyl]-3-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(Cn2cccn2)cc1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H23N5O2/c28-21-3-1-14-27(21)20-10-8-19(9-11-20)25-22(29)23-15-17-4-6-18(7-5-17)16-26-13-2-12-24-26/h2,4-13H,1,3,14-16H2,(H2,23,25,29) |
| InChIKey | POEBOFLVQKCLHY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |