C29H30N5+ — CID 2320764
3-[3-[(4-benzhydrylpiperazin-4-ium-1-yl)iminomethyl]indol-1-yl]propanenitrile (PubChem CID 2320764) has the molecular formula C29H30N5+ and a molecular weight of 448.59 g/mol. Its IUPAC name is 3-[3-[(4-benzhydrylpiperazin-4-ium-1-yl)iminomethyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[(4-benzhydrylpiperazin-4-ium-1-yl)iminomethyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 2320764 |
| Molecular Formula | C29H30N5+ |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 3-[3-[(4-benzhydrylpiperazin-4-ium-1-yl)iminomethyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C=NN2CC[NH+](C(c3ccccc3)c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H29N5/c30-16-9-17-33-23-26(27-14-7-8-15-28(27)33)22-31-34-20-18-32(19-21-34)29(24-10-3-1-4-11-24)25-12-5-2-6-13-25/h1-8,10-15,22-23,29H,9,17-21H2/p+1 |
| InChIKey | ZDLNAQMHNJKJHW-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 48.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|