C22H18ClN5 — CID 6474442
N'-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]pyridine-2-carboximidamide (PubChem CID 6474442) has the molecular formula C22H18ClN5 and a molecular weight of 387.87 g/mol. Its IUPAC name is N'-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]pyridine-2-carboximidamide.
| Compound Name | N'-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 6474442 |
| Molecular Formula | C22H18ClN5 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N'-[(E)-[1-[(4-chlorophenyl)methyl]indol-3-yl]methylideneamino]pyridine-2-carboximidamide |
| SMILES | N/C(=N/N=C/c1cn(Cc2ccc(Cl)cc2)c2ccccc12)c1ccccn1 |
| InChI | InChI=1S/C22H18ClN5/c23-18-10-8-16(9-11-18)14-28-15-17(19-5-1-2-7-21(19)28)13-26-27-22(24)20-6-3-4-12-25-20/h1-13,15H,14H2,(H2,24,27)/b26-13+ |
| InChIKey | QBHVGMQNVCJEIA-LGJNPRDNSA-N |
| XLogP | 4.48 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|