C21H18ClN5 — CID 164715497
2-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]guanidine (PubChem CID 164715497) has the molecular formula C21H18ClN5 and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 164715497 |
| Molecular Formula | C21H18ClN5 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1cn(Cc2cccc3ccccc23)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C21H18ClN5/c22-17-8-9-20-19(10-17)16(11-25-26-21(23)24)13-27(20)12-15-6-3-5-14-4-1-2-7-18(14)15/h1-11,13H,12H2,(H4,23,24,26)/b25-11+ |
| InChIKey | AIKXWCDZNRTOIW-OPEKNORGSA-N |
| XLogP | 4.10 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|