C22H19ClN4 — CID 172962475
N'-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]ethanimidamide (PubChem CID 172962475) has the molecular formula C22H19ClN4 and a molecular weight of 374.88 g/mol. Its IUPAC name is N'-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]ethanimidamide.
| Compound Name | N'-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]ethanimidamide |
|---|---|
| PubChem CID | 172962475 |
| Molecular Formula | C22H19ClN4 |
| Molecular Weight | 374.88 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N'-[(E)-[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylideneamino]ethanimidamide |
| SMILES | CC(N)=N/N=C/c1cn(Cc2cccc3ccccc23)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H19ClN4/c1-15(24)26-25-12-18-14-27(22-10-9-19(23)11-21(18)22)13-17-7-4-6-16-5-2-3-8-20(16)17/h2-12,14H,13H2,1H3,(H2,24,26)/b25-12+ |
| InChIKey | ODVYYZLLTXLTQS-BRJLIKDPSA-N |
| XLogP | 5.21 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.88 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|