C25H17ClN2O3 — CID 149237740
(3Z)-3-[[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]piperidine-2,4,6-trione (PubChem CID 149237740) has the molecular formula C25H17ClN2O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is (3Z)-3-[[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]piperidine-2,4,6-trione.
| Compound Name | (3Z)-3-[[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]piperidine-2,4,6-trione |
|---|---|
| PubChem CID | 149237740 |
| Molecular Formula | C25H17ClN2O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (3Z)-3-[[5-chloro-1-(naphthalen-1-ylmethyl)indol-3-yl]methylidene]piperidine-2,4,6-trione |
| SMILES | O=C1CC(=O)/C(=C/c2cn(Cc3cccc4ccccc34)c3ccc(Cl)cc23)C(=O)N1 |
| InChI | InChI=1S/C25H17ClN2O3/c26-18-8-9-22-20(11-18)17(10-21-23(29)12-24(30)27-25(21)31)14-28(22)13-16-6-3-5-15-4-1-2-7-19(15)16/h1-11,14H,12-13H2,(H,27,30,31)/b21-10- |
| InChIKey | XLOFXJWCGLXXDP-FBHDLOMBSA-N |
| XLogP | 4.50 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|