C16H10ClN3O3 — CID 164513021
5-[(5-chloro-1-prop-2-ynylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 164513021) has the molecular formula C16H10ClN3O3 and a molecular weight of 327.73 g/mol. Its IUPAC name is 5-[(5-chloro-1-prop-2-ynylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(5-chloro-1-prop-2-ynylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164513021 |
| Molecular Formula | C16H10ClN3O3 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-[(5-chloro-1-prop-2-ynylindol-3-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C#CCn1cc(C=C2C(=O)NC(=O)NC2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H10ClN3O3/c1-2-5-20-8-9(11-7-10(17)3-4-13(11)20)6-12-14(21)18-16(23)19-15(12)22/h1,3-4,6-8H,5H2,(H2,18,19,21,22,23) |
| InChIKey | KESVLFKVZJIBEL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|