C13H10ClN3O5 — CID 126226509
2-[4-chloro-2-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126226509) has the molecular formula C13H10ClN3O5 and a molecular weight of 323.69 g/mol. Its IUPAC name is 2-[4-chloro-2-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | 2-[4-chloro-2-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126226509 |
| Molecular Formula | C13H10ClN3O5 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[4-chloro-2-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Cl)cc1C=C1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C13H10ClN3O5/c14-7-1-2-9(22-5-10(15)18)6(3-7)4-8-11(19)16-13(21)17-12(8)20/h1-4H,5H2,(H2,15,18)(H2,16,17,19,20,21) |
| InChIKey | WPMTWBOLDPCORJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|