C13H9ClN2O6 — CID 3144103
2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 3144103) has the molecular formula C13H9ClN2O6 and a molecular weight of 324.68 g/mol. Its IUPAC name is 2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3144103 |
| Molecular Formula | C13H9ClN2O6 |
| Molecular Weight | 324.68 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | 2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1Cl |
| InChI | InChI=1S/C13H9ClN2O6/c14-8-4-6(1-2-9(8)22-5-10(17)18)3-7-11(19)15-13(21)16-12(7)20/h1-4H,5H2,(H,17,18)(H2,15,16,19,20,21) |
| InChIKey | VAGJVAMGYHYAPQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.68 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|