C14H12N2O7 — CID 2864312
2-[2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (PubChem CID 2864312) has the molecular formula C14H12N2O7 and a molecular weight of 320.26 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 2864312 |
| Molecular Formula | C14H12N2O7 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-[2-methoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(C=C2C(=O)NC(=O)NC2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C14H12N2O7/c1-22-10-5-7(2-3-9(10)23-6-11(17)18)4-8-12(19)15-14(21)16-13(8)20/h2-5H,6H2,1H3,(H,17,18)(H2,15,16,19,20,21) |
| InChIKey | VITYQFLQXINAEE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|