C16H16N2O7 — CID 2241984
methyl 2-[2-methoxy-4-[(E)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2241984) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl 2-[2-methoxy-4-[(E)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-methoxy-4-[(E)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2241984 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 2-[2-methoxy-4-[(E)-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=C2\C(=O)NC(=O)N(C)C2=O)cc1OC |
| InChI | InChI=1S/C16H16N2O7/c1-18-15(21)10(14(20)17-16(18)22)6-9-4-5-11(12(7-9)23-2)25-8-13(19)24-3/h4-7H,8H2,1-3H3,(H,17,20,22)/b10-6+ |
| InChIKey | ICWJFQFABIDGKZ-UXBLZVDNSA-N |
| XLogP | 0.34 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|