C19H20N2O7 — CID 50873072
ethyl 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 50873072) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is ethyl 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 50873072 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | ethyl 2-[2-methoxy-4-[(Z)-(2,4,6-trioxo-1-prop-2-enyl-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | C=CCN1C(=O)NC(=O)/C(=C/c2ccc(OCC(=O)OCC)c(OC)c2)C1=O |
| InChI | InChI=1S/C19H20N2O7/c1-4-8-21-18(24)13(17(23)20-19(21)25)9-12-6-7-14(15(10-12)26-3)28-11-16(22)27-5-2/h4,6-7,9-10H,1,5,8,11H2,2-3H3,(H,20,23,25)/b13-9- |
| InChIKey | PHMBXGRRUUNOHL-LCYFTJDESA-N |
| XLogP | 1.28 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|