C15H13N2O7- — CID 2276048
2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2276048) has the molecular formula C15H13N2O7- and a molecular weight of 333.28 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2276048 |
| Molecular Formula | C15H13N2O7- |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-[2-ethoxy-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)NC2=O)ccc1OCC(=O)[O-] |
| InChI | InChI=1S/C15H14N2O7/c1-2-23-11-6-8(3-4-10(11)24-7-12(18)19)5-9-13(20)16-15(22)17-14(9)21/h3-6H,2,7H2,1H3,(H,18,19)(H2,16,17,20,21,22)/p-1 |
| InChIKey | DXAXOOQVRQXSQL-UHFFFAOYSA-M |
| XLogP | -1.04 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|