C19H13Cl2N3O5 — CID 126278908
N-(2-chlorophenyl)-2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126278908) has the molecular formula C19H13Cl2N3O5 and a molecular weight of 434.24 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126278908 |
| Molecular Formula | C19H13Cl2N3O5 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2-chloro-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1Cl)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H13Cl2N3O5/c20-12-3-1-2-4-14(12)22-16(25)9-29-15-6-5-10(8-13(15)21)7-11-17(26)23-19(28)24-18(11)27/h1-8H,9H2,(H,22,25)(H2,23,24,26,27,28) |
| InChIKey | SAKQGUDVVDZXOG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|