C21H18BrN3O5 — CID 126266401
2-[2-bromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 126266401) has the molecular formula C21H18BrN3O5 and a molecular weight of 472.30 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126266401 |
| Molecular Formula | C21H18BrN3O5 |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 2-[2-bromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)COc2ccc(C=C3C(=O)NC(=O)NC3=O)cc2Br)c1C |
| InChI | InChI=1S/C21H18BrN3O5/c1-11-4-3-5-16(12(11)2)23-18(26)10-30-17-7-6-13(9-15(17)22)8-14-19(27)24-21(29)25-20(14)28/h3-9H,10H2,1-2H3,(H,23,26)(H2,24,25,27,28,29) |
| InChIKey | NBIKYJLJRGXUBG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|