C19H12Br2ClN3O5 — CID 126260821
N-(2-chlorophenyl)-2-[2,6-dibromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 126260821) has the molecular formula C19H12Br2ClN3O5 and a molecular weight of 557.58 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[2,6-dibromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[2,6-dibromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126260821 |
| Molecular Formula | C19H12Br2ClN3O5 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 554.88 |
| IUPAC Name | N-(2-chlorophenyl)-2-[2,6-dibromo-4-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1c(Br)cc(C=C2C(=O)NC(=O)NC2=O)cc1Br)Nc1ccccc1Cl |
| InChI | InChI=1S/C19H12Br2ClN3O5/c20-11-6-9(5-10-17(27)24-19(29)25-18(10)28)7-12(21)16(11)30-8-15(26)23-14-4-2-1-3-13(14)22/h1-7H,8H2,(H,23,26)(H2,24,25,27,28,29) |
| InChIKey | XYNYWWSHCHQTIO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|